C9H15IN4 — CID 65252615
4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 65252615) has the molecular formula C9H15IN4 and a molecular weight of 306.15 g/mol. Its IUPAC name is 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanimidamide.
| Compound Name | 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65252615 |
| Molecular Formula | C9H15IN4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCn1cc(I)cn1 |
| InChI | InChI=1S/C9H15IN4/c1-9(2,8(11)12)3-4-14-6-7(10)5-13-14/h5-6H,3-4H2,1-2H3,(H3,11,12) |
| InChIKey | YPSDBWGXOQLCCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|