C12H22N4O2S — CID 165480993
2,2-dimethyl-6-(4-methylsulfonylpyrazol-1-yl)hexanimidamide (PubChem CID 165480993) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-methylsulfonylpyrazol-1-yl)hexanimidamide.
| Compound Name | 2,2-dimethyl-6-(4-methylsulfonylpyrazol-1-yl)hexanimidamide |
|---|---|
| PubChem CID | 165480993 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2,2-dimethyl-6-(4-methylsulfonylpyrazol-1-yl)hexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCn1cc(S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C12H22N4O2S/c1-12(2,11(13)14)6-4-5-7-16-9-10(8-15-16)19(3,17)18/h8-9H,4-7H2,1-3H3,(H3,13,14) |
| InChIKey | QVYYIZXKCCACLA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|