C11H17ClN2O2 — CID 106714172
6-(4-chloropyrazol-1-yl)-2,2-dimethylhexanoic acid (PubChem CID 106714172) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 6-(4-chloropyrazol-1-yl)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(4-chloropyrazol-1-yl)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714172 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 6-(4-chloropyrazol-1-yl)-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCn1cc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C11H17ClN2O2/c1-11(2,10(15)16)5-3-4-6-14-8-9(12)7-13-14/h7-8H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | YBKJWQBJJRHZEQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|