C8H13ClN4O — CID 79631561
3-(4-chloropyrazol-1-yl)-2,2-dimethylpropanehydrazide (PubChem CID 79631561) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 3-(4-chloropyrazol-1-yl)-2,2-dimethylpropanehydrazide.
| Compound Name | 3-(4-chloropyrazol-1-yl)-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 79631561 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-(4-chloropyrazol-1-yl)-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(Cn1cc(Cl)cn1)C(=O)NN |
| InChI | InChI=1S/C8H13ClN4O/c1-8(2,7(14)12-10)5-13-4-6(9)3-11-13/h3-4H,5,10H2,1-2H3,(H,12,14) |
| InChIKey | WWNZEOSZADZTRX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|