C13H15IN4O — CID 116694055
2-amino-4-(4-iodopyrazol-1-yl)-2-phenylbutanamide (PubChem CID 116694055) has the molecular formula C13H15IN4O and a molecular weight of 370.19 g/mol. Its IUPAC name is 2-amino-4-(4-iodopyrazol-1-yl)-2-phenylbutanamide.
| Compound Name | 2-amino-4-(4-iodopyrazol-1-yl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 116694055 |
| Molecular Formula | C13H15IN4O |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-amino-4-(4-iodopyrazol-1-yl)-2-phenylbutanamide |
| SMILES | NC(=O)C(N)(CCn1cc(I)cn1)c1ccccc1 |
| InChI | InChI=1S/C13H15IN4O/c14-11-8-17-18(9-11)7-6-13(16,12(15)19)10-4-2-1-3-5-10/h1-5,8-9H,6-7,16H2,(H2,15,19) |
| InChIKey | MPTNTMZYTFDBAH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|