C14H21N3O2S — CID 116693803
2-amino-4-(1-oxo-1,4-thiazinan-4-yl)-2-phenylbutanamide (PubChem CID 116693803) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-amino-4-(1-oxo-1,4-thiazinan-4-yl)-2-phenylbutanamide.
| Compound Name | 2-amino-4-(1-oxo-1,4-thiazinan-4-yl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 116693803 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-amino-4-(1-oxo-1,4-thiazinan-4-yl)-2-phenylbutanamide |
| SMILES | NC(=O)C(N)(CCN1CCS(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O2S/c15-13(18)14(16,12-4-2-1-3-5-12)6-7-17-8-10-20(19)11-9-17/h1-5H,6-11,16H2,(H2,15,18) |
| InChIKey | YWLXICZGOIOEPL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |