C14H20N2O2S — CID 142798440
2-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide (PubChem CID 142798440) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide.
| Compound Name | 2-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 142798440 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide |
| SMILES | NC(=O)c1ccccc1CCCN1CCS(=O)CC1 |
| InChI | InChI=1S/C14H20N2O2S/c15-14(17)13-6-2-1-4-12(13)5-3-7-16-8-10-19(18)11-9-16/h1-2,4,6H,3,5,7-11H2,(H2,15,17) |
| InChIKey | VBTLOHLLTBBHAN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |