C12H14BrNO2S — CID 54977317
1-(2-bromophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 54977317) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone.
| Compound Name | 1-(2-bromophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 54977317 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 1-(2-bromophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | O=C(CN1CCS(=O)CC1)c1ccccc1Br |
| InChI | InChI=1S/C12H14BrNO2S/c13-11-4-2-1-3-10(11)12(15)9-14-5-7-17(16)8-6-14/h1-4H,5-9H2 |
| InChIKey | VGTVPISOGDXFST-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |