C14H21N3O — CID 55097569
2-[(2-pyrrolidin-1-ylethylamino)methyl]benzamide (PubChem CID 55097569) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(2-pyrrolidin-1-ylethylamino)methyl]benzamide.
| Compound Name | 2-[(2-pyrrolidin-1-ylethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 55097569 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-[(2-pyrrolidin-1-ylethylamino)methyl]benzamide |
| SMILES | NC(=O)c1ccccc1CNCCN1CCCC1 |
| InChI | InChI=1S/C14H21N3O/c15-14(18)13-6-2-1-5-12(13)11-16-7-10-17-8-3-4-9-17/h1-2,5-6,16H,3-4,7-11H2,(H2,15,18) |
| InChIKey | DHYSOWFWXBUOGB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|