C14H22N2O2 — CID 114009117
2-[(6-hydroxyhexylamino)methyl]benzamide (PubChem CID 114009117) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[(6-hydroxyhexylamino)methyl]benzamide.
| Compound Name | 2-[(6-hydroxyhexylamino)methyl]benzamide |
|---|---|
| PubChem CID | 114009117 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[(6-hydroxyhexylamino)methyl]benzamide |
| SMILES | NC(=O)c1ccccc1CNCCCCCCO |
| InChI | InChI=1S/C14H22N2O2/c15-14(18)13-8-4-3-7-12(13)11-16-9-5-1-2-6-10-17/h3-4,7-8,16-17H,1-2,5-6,9-11H2,(H2,15,18) |
| InChIKey | KRHUXLULYXTSBH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|