C12H22N4S — CID 65249255
2,2-dimethyl-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanethioamide (PubChem CID 65249255) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 2,2-dimethyl-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanethioamide.
| Compound Name | 2,2-dimethyl-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanethioamide |
|---|---|
| PubChem CID | 65249255 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2,2-dimethyl-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanethioamide |
| SMILES | CN(CCC(C)(C)C(N)=S)Cc1cnn(C)c1 |
| InChI | InChI=1S/C12H22N4S/c1-12(2,11(13)17)5-6-15(3)8-10-7-14-16(4)9-10/h7,9H,5-6,8H2,1-4H3,(H2,13,17) |
| InChIKey | MGACSQGYZIMPQG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|