C12H20N4OS — CID 114292030
2-carbamothioyl-N,2-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]butanamide (PubChem CID 114292030) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 2-carbamothioyl-N,2-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]butanamide.
| Compound Name | 2-carbamothioyl-N,2-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 114292030 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-carbamothioyl-N,2-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]butanamide |
| SMILES | CCC(C)(C(=O)N(C)Cc1cnn(C)c1)C(N)=S |
| InChI | InChI=1S/C12H20N4OS/c1-5-12(2,10(13)18)11(17)15(3)7-9-6-14-16(4)8-9/h6,8H,5,7H2,1-4H3,(H2,13,18) |
| InChIKey | RIQKTNOUWRFPSR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|