C14H24N4 — CID 106713533
6-[2-(ethylaminomethyl)imidazol-1-yl]-2,2-dimethylhexanenitrile (PubChem CID 106713533) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 6-[2-(ethylaminomethyl)imidazol-1-yl]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2-(ethylaminomethyl)imidazol-1-yl]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713533 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 6-[2-(ethylaminomethyl)imidazol-1-yl]-2,2-dimethylhexanenitrile |
| SMILES | CCNCc1nccn1CCCCC(C)(C)C#N |
| InChI | InChI=1S/C14H24N4/c1-4-16-11-13-17-8-10-18(13)9-6-5-7-14(2,3)12-15/h8,10,16H,4-7,9,11H2,1-3H3 |
| InChIKey | OYAAIJARVFKMED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|