C13H18ClN3O — CID 106713682
6-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106713682) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713682 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 6-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | Cc1nc(Cl)cc(=O)n1CCCCC(C)(C)C#N |
| InChI | InChI=1S/C13H18ClN3O/c1-10-16-11(14)8-12(18)17(10)7-5-4-6-13(2,3)9-15/h8H,4-7H2,1-3H3 |
| InChIKey | FCYOLPRONKKREE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|