C14H23ClN2O — CID 114201135
6-chloro-3-(2,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one (PubChem CID 114201135) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 6-chloro-3-(2,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one.
| Compound Name | 6-chloro-3-(2,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 114201135 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-chloro-3-(2,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one |
| SMILES | CC(C)CC(C)Cn1c(C(C)C)nc(Cl)cc1=O |
| InChI | InChI=1S/C14H23ClN2O/c1-9(2)6-11(5)8-17-13(18)7-12(15)16-14(17)10(3)4/h7,9-11H,6,8H2,1-5H3 |
| InChIKey | QSIOXICBCIBCMB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |