C14H22N2O3 — CID 106714133
6-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylhexanoic acid (PubChem CID 106714133) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 6-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714133 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 6-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylhexanoic acid |
| SMILES | Cc1cc(C)n(CCCCC(C)(C)C(=O)O)c(=O)n1 |
| InChI | InChI=1S/C14H22N2O3/c1-10-9-11(2)16(13(19)15-10)8-6-5-7-14(3,4)12(17)18/h9H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | NCBJLTRUGQBMMP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|