C17H23NO2 — CID 106714189
2,2-dimethyl-6-(5-methylindol-1-yl)hexanoic acid (PubChem CID 106714189) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,2-dimethyl-6-(5-methylindol-1-yl)hexanoic acid.
| Compound Name | 2,2-dimethyl-6-(5-methylindol-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 106714189 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2,2-dimethyl-6-(5-methylindol-1-yl)hexanoic acid |
| SMILES | Cc1ccc2c(ccn2CCCCC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO2/c1-13-6-7-15-14(12-13)8-11-18(15)10-5-4-9-17(2,3)16(19)20/h6-8,11-12H,4-5,9-10H2,1-3H3,(H,19,20) |
| InChIKey | CWRHJVMBJIDLNF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|