C15H18FNO2 — CID 65255255
5-(5-fluoroindol-1-yl)-2,2-dimethylpentanoic acid (PubChem CID 65255255) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is 5-(5-fluoroindol-1-yl)-2,2-dimethylpentanoic acid.
| Compound Name | 5-(5-fluoroindol-1-yl)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 65255255 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-(5-fluoroindol-1-yl)-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCn1ccc2cc(F)ccc21)C(=O)O |
| InChI | InChI=1S/C15H18FNO2/c1-15(2,14(18)19)7-3-8-17-9-6-11-10-12(16)4-5-13(11)17/h4-6,9-10H,3,7-8H2,1-2H3,(H,18,19) |
| InChIKey | QOHRGCMSEREBDG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |