C11H23NO4S — CID 106714759
methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate (PubChem CID 106714759) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate.
| Compound Name | methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate |
|---|---|
| PubChem CID | 106714759 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)CCCCC(C)(C)CN |
| InChI | InChI=1S/C11H23NO4S/c1-11(2,9-12)6-4-5-7-17(14,15)8-10(13)16-3/h4-9,12H2,1-3H3 |
| InChIKey | ALUQOVRTWPOGPG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|