methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate

C11H23NO4S — CID 106714759

IUPACmethyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate
SMILESCOC(=O)CS(=O)(=O)CCCCC(C)(C)CN
InChIInChI=1S/C11H23NO4S/c1-11(2,9-12)6-4-5-7-17(14,15)8-10(13)16-3/h4-9,12H2,1-3H3
InChIKeyALUQOVRTWPOGPG-UHFFFAOYSA-N
MW265.37 g/mol
LogP0.73
Rot. Bonds8

About methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate

methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate (PubChem CID 106714759) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate.

Molecular Properties

Compound Namemethyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate
PubChem CID106714759
Molecular FormulaC11H23NO4S
Molecular Weight265.37 g/mol
Exact Mass265.13
IUPAC Namemethyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate
SMILESCOC(=O)CS(=O)(=O)CCCCC(C)(C)CN
InChIInChI=1S/C11H23NO4S/c1-11(2,9-12)6-4-5-7-17(14,15)8-10(13)16-3/h4-9,12H2,1-3H3
InChIKeyALUQOVRTWPOGPG-UHFFFAOYSA-N
XLogP0.73
TPSA86.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.37
LogP ≤ 50.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate?
The IUPAC name of methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate (CID 106714759) is methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate.
What is the SMILES notation for methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate?
The canonical SMILES for methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate is COC(=O)CS(=O)(=O)CCCCC(C)(C)CN.
What is the InChIKey of methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate?
The InChIKey is ALUQOVRTWPOGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4S/c1-11(2,9-12)6-4-5-7-17(14,15)8-10(13)16-3/h4-9,12H2,1-3H3.
What are the key properties of methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate?
methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate has a molecular weight of 265.37 g/mol, XLogP of 0.73, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-amino-5,5-dimethylhexyl)sulfonylacetate is sourced from PubChem (CID 106714759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).