C13H20N4O — CID 106714919
2,2-dimethyl-6-[4-(methylamino)-6-oxopyridazin-1-yl]hexanenitrile (PubChem CID 106714919) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,2-dimethyl-6-[4-(methylamino)-6-oxopyridazin-1-yl]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[4-(methylamino)-6-oxopyridazin-1-yl]hexanenitrile |
|---|---|
| PubChem CID | 106714919 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2,2-dimethyl-6-[4-(methylamino)-6-oxopyridazin-1-yl]hexanenitrile |
| SMILES | CNc1cnn(CCCCC(C)(C)C#N)c(=O)c1 |
| InChI | InChI=1S/C13H20N4O/c1-13(2,10-14)6-4-5-7-17-12(18)8-11(15-3)9-16-17/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | SWZLVHZDTYOZFB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|