C12H10BrN5S — CID 106715705
2-(5-bromothiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-amine (PubChem CID 106715705) has the molecular formula C12H10BrN5S and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-amine.
| Compound Name | 2-(5-bromothiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106715705 |
| Molecular Formula | C12H10BrN5S |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-amine |
| SMILES | Cn1cc(-c2cc(N)nc(-c3ccc(Br)s3)n2)cn1 |
| InChI | InChI=1S/C12H10BrN5S/c1-18-6-7(5-15-18)8-4-11(14)17-12(16-8)9-2-3-10(13)19-9/h2-6H,1H3,(H2,14,16,17) |
| InChIKey | GTSCCPCRIDIJQZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |