C14H16N6S — CID 106716236
[2-(5-ethylthiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine (PubChem CID 106716236) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is [2-(5-ethylthiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(5-ethylthiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106716236 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [2-(5-ethylthiophen-2-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CCc1ccc(-c2nc(NN)cc(-c3cnn(C)c3)n2)s1 |
| InChI | InChI=1S/C14H16N6S/c1-3-10-4-5-12(21-10)14-17-11(6-13(18-14)19-15)9-7-16-20(2)8-9/h4-8H,3,15H2,1-2H3,(H,17,18,19) |
| InChIKey | VGJRMZQQZWUUHH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|