C8H11N3O2 — CID 106716614
N-ethyl-2-(4-formylimidazol-1-yl)acetamide (PubChem CID 106716614) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-ethyl-2-(4-formylimidazol-1-yl)acetamide.
| Compound Name | N-ethyl-2-(4-formylimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 106716614 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-ethyl-2-(4-formylimidazol-1-yl)acetamide |
| SMILES | CCNC(=O)Cn1cnc(C=O)c1 |
| InChI | InChI=1S/C8H11N3O2/c1-2-9-8(13)4-11-3-7(5-12)10-6-11/h3,5-6H,2,4H2,1H3,(H,9,13) |
| InChIKey | GIPRXZGLIMBZNV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|