About [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol
[1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol (PubChem CID 106717253) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol |
| PubChem CID | 106717253 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol |
| SMILES | Cn1cnnc1Cn1cnc(CO)c1 |
| InChI | InChI=1S/C8H11N5O/c1-12-6-10-11-8(12)3-13-2-7(4-14)9-5-13/h2,5-6,14H,3-4H2,1H3 |
| InChIKey | MRSKAOCKZBHGSK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
The IUPAC name of [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol (CID 106717253) is [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol.
What is the SMILES notation for [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
The canonical SMILES for [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol is Cn1cnnc1Cn1cnc(CO)c1.
What is the InChIKey of [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
The InChIKey is MRSKAOCKZBHGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-12-6-10-11-8(12)3-13-2-7(4-14)9-5-13/h2,5-6,14H,3-4H2,1H3.
What are the key properties of [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol?
[1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol has a molecular weight of 193.21 g/mol, XLogP of -0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methanol is sourced from PubChem (CID 106717253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).