C12H20N6 — CID 114204643
N-[[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methyl]propan-1-amine (PubChem CID 114204643) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114204643 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N-[[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]imidazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(Cc2nncn2CC)cn1 |
| InChI | InChI=1S/C12H20N6/c1-3-5-13-6-11-7-17(9-14-11)8-12-16-15-10-18(12)4-2/h7,9-10,13H,3-6,8H2,1-2H3 |
| InChIKey | NGDFPFLNTZXOES-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|