C16H21N3OS — CID 106720338
N-[[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)imidazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 106720338) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)imidazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)imidazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 106720338 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)imidazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cn(CC2Cc3ccccc3S2)cn1 |
| InChI | InChI=1S/C16H21N3OS/c1-20-7-6-17-9-14-10-19(12-18-14)11-15-8-13-4-2-3-5-16(13)21-15/h2-5,10,12,15,17H,6-9,11H2,1H3 |
| InChIKey | HNKBSGXVJVXPFC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|