C14H17N3OS2 — CID 79205801
N-[[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 79205801) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79205801 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnc(C2Cc3ccccc3S2)s1 |
| InChI | InChI=1S/C14H17N3OS2/c1-18-7-6-15-9-13-16-17-14(20-13)12-8-10-4-2-3-5-11(10)19-12/h2-5,12,15H,6-9H2,1H3 |
| InChIKey | HSISGKVVJYDIJY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|