C12H21N3OS2 — CID 83136195
2-methoxy-N-[[5-(thian-4-ylmethyl)-1,3,4-thiadiazol-2-yl]methyl]ethanamine (PubChem CID 83136195) has the molecular formula C12H21N3OS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-methoxy-N-[[5-(thian-4-ylmethyl)-1,3,4-thiadiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[5-(thian-4-ylmethyl)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 83136195 |
| Molecular Formula | C12H21N3OS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-methoxy-N-[[5-(thian-4-ylmethyl)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
| SMILES | COCCNCc1nnc(CC2CCSCC2)s1 |
| InChI | InChI=1S/C12H21N3OS2/c1-16-5-4-13-9-12-15-14-11(18-12)8-10-2-6-17-7-3-10/h10,13H,2-9H2,1H3 |
| InChIKey | UIOMNMJNXTZYRF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|