C11H14BrN3OS2 — CID 79996523
N-[[5-(5-bromo-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 79996523) has the molecular formula C11H14BrN3OS2 and a molecular weight of 348.29 g/mol. Its IUPAC name is N-[[5-(5-bromo-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(5-bromo-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79996523 |
| Molecular Formula | C11H14BrN3OS2 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | N-[[5-(5-bromo-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnc(-c2cc(C)c(Br)s2)s1 |
| InChI | InChI=1S/C11H14BrN3OS2/c1-7-5-8(17-10(7)12)11-15-14-9(18-11)6-13-3-4-16-2/h5,13H,3-4,6H2,1-2H3 |
| InChIKey | OOWMVILZXMZYQA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|