C13H22BrNOS — CID 79992461
3-(5-bromo-4-methylthiophen-2-yl)-N-(2-methoxyethyl)-3-methylbutan-1-amine (PubChem CID 79992461) has the molecular formula C13H22BrNOS and a molecular weight of 320.30 g/mol. Its IUPAC name is 3-(5-bromo-4-methylthiophen-2-yl)-N-(2-methoxyethyl)-3-methylbutan-1-amine.
| Compound Name | 3-(5-bromo-4-methylthiophen-2-yl)-N-(2-methoxyethyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 79992461 |
| Molecular Formula | C13H22BrNOS |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-(5-bromo-4-methylthiophen-2-yl)-N-(2-methoxyethyl)-3-methylbutan-1-amine |
| SMILES | COCCNCCC(C)(C)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C13H22BrNOS/c1-10-9-11(17-12(10)14)13(2,3)5-6-15-7-8-16-4/h9,15H,5-8H2,1-4H3 |
| InChIKey | AAHXSYPCJXVSMM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|