C13H21Br2NS — CID 80534974
3-(4,5-dibromothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 80534974) has the molecular formula C13H21Br2NS and a molecular weight of 383.19 g/mol. Its IUPAC name is 3-(4,5-dibromothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 3-(4,5-dibromothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 80534974 |
| Molecular Formula | C13H21Br2NS |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 3-(4,5-dibromothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCCC(C)(C)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H21Br2NS/c1-9(2)8-16-6-5-13(3,4)11-7-10(14)12(15)17-11/h7,9,16H,5-6,8H2,1-4H3 |
| InChIKey | NKBDMGZMVICDPR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|