C14H24BrNS — CID 79830232
3-(5-bromo-2-methylthiophen-3-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 79830232) has the molecular formula C14H24BrNS and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-(5-bromo-2-methylthiophen-3-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 3-(5-bromo-2-methylthiophen-3-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 79830232 |
| Molecular Formula | C14H24BrNS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-(5-bromo-2-methylthiophen-3-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | Cc1sc(Br)cc1C(C)(C)CCNCC(C)C |
| InChI | InChI=1S/C14H24BrNS/c1-10(2)9-16-7-6-14(4,5)12-8-13(15)17-11(12)3/h8,10,16H,6-7,9H2,1-5H3 |
| InChIKey | GYZANRISVCFFMN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|