C25H24N5O3P — CID 10672147
N-(diphenoxyphosphorylmethyl)-4-(4-methylphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine (PubChem CID 10672147) has the molecular formula C25H24N5O3P and a molecular weight of 473.47 g/mol. Its IUPAC name is N-(diphenoxyphosphorylmethyl)-4-(4-methylphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine.
| Compound Name | N-(diphenoxyphosphorylmethyl)-4-(4-methylphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 10672147 |
| Molecular Formula | C25H24N5O3P |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-(diphenoxyphosphorylmethyl)-4-(4-methylphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine |
| SMILES | Cc1ccc(C#CCC(NCP(=O)(Oc2ccccc2)Oc2ccccc2)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H24N5O3P/c1-20-15-17-21(18-16-20)9-8-14-24(25-27-29-30-28-25)26-19-34(31,32-22-10-4-2-5-11-22)33-23-12-6-3-7-13-23/h2-7,10-13,15-18,24,26H,14,19H2,1H3,(H,27,28,29,30) |
| InChIKey | GZEANVDNIIMRGJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|