C25H24N5O4P — CID 10576990
(1S)-N-(diphenoxyphosphorylmethyl)-4-(2-methoxyphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine (PubChem CID 10576990) has the molecular formula C25H24N5O4P and a molecular weight of 489.47 g/mol. Its IUPAC name is (1S)-N-(diphenoxyphosphorylmethyl)-4-(2-methoxyphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine.
| Compound Name | (1S)-N-(diphenoxyphosphorylmethyl)-4-(2-methoxyphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 10576990 |
| Molecular Formula | C25H24N5O4P |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (1S)-N-(diphenoxyphosphorylmethyl)-4-(2-methoxyphenyl)-1-(2H-tetrazol-5-yl)but-3-yn-1-amine |
| SMILES | COc1ccccc1C#CC[C@H](NCP(=O)(Oc1ccccc1)Oc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C25H24N5O4P/c1-32-24-18-9-8-11-20(24)12-10-17-23(25-27-29-30-28-25)26-19-35(31,33-21-13-4-2-5-14-21)34-22-15-6-3-7-16-22/h2-9,11,13-16,18,23,26H,17,19H2,1H3,(H,27,28,29,30)/t23-/m0/s1 |
| InChIKey | WWLIBCHBQCBCDJ-QHCPKHFHSA-N |
| XLogP | 4.59 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|