C19H27N2O7P — CID 10693701
(2S)-2-[[(2S)-5-(2-methoxyphenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid (PubChem CID 10693701) has the molecular formula C19H27N2O7P and a molecular weight of 426.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(2-methoxyphenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-(2-methoxyphenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 10693701 |
| Molecular Formula | C19H27N2O7P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (2S)-2-[[(2S)-5-(2-methoxyphenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccccc1C#CC[C@H](NCP(=O)(O)O)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C19H27N2O7P/c1-13(2)11-16(19(23)24)21-18(22)15(20-12-29(25,26)27)9-6-8-14-7-4-5-10-17(14)28-3/h4-5,7,10,13,15-16,20H,9,11-12H2,1-3H3,(H,21,22)(H,23,24)(H2,25,26,27)/t15-,16-/m0/s1 |
| InChIKey | ZDYHILCYVCQAML-HOTGVXAUSA-N |
| XLogP | 1.15 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|