C19H28N2O5 — CID 120695779
(2S)-2-[[2-[3-(2-methoxyphenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120695779) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2S)-2-[[2-[3-(2-methoxyphenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[3-(2-methoxyphenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120695779 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (2S)-2-[[2-[3-(2-methoxyphenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccccc1C(C)CC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C19H28N2O5/c1-12(2)9-15(19(24)25)21-18(23)11-20-17(22)10-13(3)14-7-5-6-8-16(14)26-4/h5-8,12-13,15H,9-11H2,1-4H3,(H,20,22)(H,21,23)(H,24,25)/t13?,15-/m0/s1 |
| InChIKey | NAQACDYUPCQXOM-WUJWULDRSA-N |
| XLogP | 1.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |