C18H25FN2O4 — CID 120695191
(2S)-2-[[2-[3-(3-fluorophenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120695191) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is (2S)-2-[[2-[3-(3-fluorophenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[3-(3-fluorophenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120695191 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2S)-2-[[2-[3-(3-fluorophenyl)butanoylamino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)CC(C)c1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C18H25FN2O4/c1-11(2)7-15(18(24)25)21-17(23)10-20-16(22)8-12(3)13-5-4-6-14(19)9-13/h4-6,9,11-12,15H,7-8,10H2,1-3H3,(H,20,22)(H,21,23)(H,24,25)/t12?,15-/m0/s1 |
| InChIKey | QPLCBATUESIYBG-CVRLYYSRSA-N |
| XLogP | 2.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |