C30H35NO5 — CID 129246167
2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]-4-methylpentanoic acid (PubChem CID 129246167) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]-4-methylpentanoic acid.
| Compound Name | 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 129246167 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)CC(C)c1ccc(OCc2ccccc2)cc1OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H35NO5/c1-21(2)16-27(30(33)34)31-29(32)17-22(3)26-15-14-25(35-19-23-10-6-4-7-11-23)18-28(26)36-20-24-12-8-5-9-13-24/h4-15,18,21-22,27H,16-17,19-20H2,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | JXOPSCTURSJZHD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |