C28H31NO5 — CID 129246220
methyl 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]propanoate (PubChem CID 129246220) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]propanoate.
| Compound Name | methyl 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]propanoate |
|---|---|
| PubChem CID | 129246220 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | methyl 2-[3-[2,4-bis(phenylmethoxy)phenyl]butanoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CC(C)c1ccc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C28H31NO5/c1-20(16-27(30)29-21(2)28(31)32-3)25-15-14-24(33-18-22-10-6-4-7-11-22)17-26(25)34-19-23-12-8-5-9-13-23/h4-15,17,20-21H,16,18-19H2,1-3H3,(H,29,30) |
| InChIKey | XKXCEUZGRCJWRR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |