C21H28F2N3O7P — CID 10601571
(2S)-2-[[(2S)-2-[[(2S)-5-(2,4-difluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoyl]amino]propanoic acid (PubChem CID 10601571) has the molecular formula C21H28F2N3O7P and a molecular weight of 503.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-5-(2,4-difluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-5-(2,4-difluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10601571 |
| Molecular Formula | C21H28F2N3O7P |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-5-(2,4-difluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoyl]amino]propanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC#Cc1ccc(F)cc1F)NCP(=O)(O)O)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H28F2N3O7P/c1-12(2)9-18(20(28)25-13(3)21(29)30)26-19(27)17(24-11-34(31,32)33)6-4-5-14-7-8-15(22)10-16(14)23/h7-8,10,12-13,17-18,24H,6,9,11H2,1-3H3,(H,25,28)(H,26,27)(H,29,30)(H2,31,32,33)/t13-,17-,18-/m0/s1 |
| InChIKey | YMFLUOCULVUGIG-KKXDTOCCSA-N |
| XLogP | 0.92 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|