C18H24FN2O6P — CID 10740493
(2S)-2-[[(2S)-5-(3-fluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid (PubChem CID 10740493) has the molecular formula C18H24FN2O6P and a molecular weight of 414.37 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(3-fluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-(3-fluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 10740493 |
| Molecular Formula | C18H24FN2O6P |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2S)-2-[[(2S)-5-(3-fluorophenyl)-2-(phosphonomethylamino)pent-4-ynoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC#Cc1cccc(F)c1)NCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C18H24FN2O6P/c1-12(2)9-16(18(23)24)21-17(22)15(20-11-28(25,26)27)8-4-6-13-5-3-7-14(19)10-13/h3,5,7,10,12,15-16,20H,8-9,11H2,1-2H3,(H,21,22)(H,23,24)(H2,25,26,27)/t15-,16-/m0/s1 |
| InChIKey | VHXDFOBQYJQMPJ-HOTGVXAUSA-N |
| XLogP | 1.28 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|