C29H28NO6P — CID 54260471
(2S)-2-(diphenoxyphosphorylmethylamino)-3-(3-methoxy-4-phenylphenyl)propanoic acid (PubChem CID 54260471) has the molecular formula C29H28NO6P and a molecular weight of 517.52 g/mol. Its IUPAC name is (2S)-2-(diphenoxyphosphorylmethylamino)-3-(3-methoxy-4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-(diphenoxyphosphorylmethylamino)-3-(3-methoxy-4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 54260471 |
| Molecular Formula | C29H28NO6P |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (2S)-2-(diphenoxyphosphorylmethylamino)-3-(3-methoxy-4-phenylphenyl)propanoic acid |
| SMILES | COc1cc(C[C@H](NCP(=O)(Oc2ccccc2)Oc2ccccc2)C(=O)O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C29H28NO6P/c1-34-28-20-22(17-18-26(28)23-11-5-2-6-12-23)19-27(29(31)32)30-21-37(33,35-24-13-7-3-8-14-24)36-25-15-9-4-10-16-25/h2-18,20,27,30H,19,21H2,1H3,(H,31,32)/t27-/m0/s1 |
| InChIKey | RDDJVMDSXSFONB-MHZLTWQESA-N |
| XLogP | 6.26 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|