C15H23NO4S — CID 106723580
methyl 2-(2-tert-butylsulfonylethylamino)-2-phenylacetate (PubChem CID 106723580) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is methyl 2-(2-tert-butylsulfonylethylamino)-2-phenylacetate.
| Compound Name | methyl 2-(2-tert-butylsulfonylethylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 106723580 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 2-(2-tert-butylsulfonylethylamino)-2-phenylacetate |
| SMILES | COC(=O)C(NCCS(=O)(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H23NO4S/c1-15(2,3)21(18,19)11-10-16-13(14(17)20-4)12-8-6-5-7-9-12/h5-9,13,16H,10-11H2,1-4H3 |
| InChIKey | QATIJNXTXLCENN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |