C14H22BrNO2S — CID 106724120
(1R)-1-(2-bromophenyl)-N-(2-tert-butylsulfonylethyl)ethanamine (PubChem CID 106724120) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is (1R)-1-(2-bromophenyl)-N-(2-tert-butylsulfonylethyl)ethanamine.
| Compound Name | (1R)-1-(2-bromophenyl)-N-(2-tert-butylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 106724120 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (1R)-1-(2-bromophenyl)-N-(2-tert-butylsulfonylethyl)ethanamine |
| SMILES | C[C@@H](NCCS(=O)(=O)C(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C14H22BrNO2S/c1-11(12-7-5-6-8-13(12)15)16-9-10-19(17,18)14(2,3)4/h5-8,11,16H,9-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | VCJRKHVJOGMRPT-LLVKDONJSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |