C10H15BrN2O2S — CID 43551890
2-[1-(2-bromophenyl)ethylamino]ethanesulfonamide (PubChem CID 43551890) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 2-[1-(2-bromophenyl)ethylamino]ethanesulfonamide.
| Compound Name | 2-[1-(2-bromophenyl)ethylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 43551890 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-[1-(2-bromophenyl)ethylamino]ethanesulfonamide |
| SMILES | CC(NCCS(N)(=O)=O)c1ccccc1Br |
| InChI | InChI=1S/C10H15BrN2O2S/c1-8(13-6-7-16(12,14)15)9-4-2-3-5-10(9)11/h2-5,8,13H,6-7H2,1H3,(H2,12,14,15) |
| InChIKey | VZQPMDNVQYDORV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |