C15H23BrO4S — CID 106726532
1-(bromomethyl)-4-propoxy-2-(2-propylsulfonylethoxy)benzene (PubChem CID 106726532) has the molecular formula C15H23BrO4S and a molecular weight of 379.32 g/mol. Its IUPAC name is 1-(bromomethyl)-4-propoxy-2-(2-propylsulfonylethoxy)benzene.
| Compound Name | 1-(bromomethyl)-4-propoxy-2-(2-propylsulfonylethoxy)benzene |
|---|---|
| PubChem CID | 106726532 |
| Molecular Formula | C15H23BrO4S |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 1-(bromomethyl)-4-propoxy-2-(2-propylsulfonylethoxy)benzene |
| SMILES | CCCOc1ccc(CBr)c(OCCS(=O)(=O)CCC)c1 |
| InChI | InChI=1S/C15H23BrO4S/c1-3-7-19-14-6-5-13(12-16)15(11-14)20-8-10-21(17,18)9-4-2/h5-6,11H,3-4,7-10,12H2,1-2H3 |
| InChIKey | ASXQANRBRHBWRN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|