C16H21BrN2O2 — CID 114528438
2-[2-[2-(bromomethyl)-5-propoxyphenoxy]ethyl]-1-methylimidazole (PubChem CID 114528438) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 2-[2-[2-(bromomethyl)-5-propoxyphenoxy]ethyl]-1-methylimidazole.
| Compound Name | 2-[2-[2-(bromomethyl)-5-propoxyphenoxy]ethyl]-1-methylimidazole |
|---|---|
| PubChem CID | 114528438 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[2-[2-(bromomethyl)-5-propoxyphenoxy]ethyl]-1-methylimidazole |
| SMILES | CCCOc1ccc(CBr)c(OCCc2nccn2C)c1 |
| InChI | InChI=1S/C16H21BrN2O2/c1-3-9-20-14-5-4-13(12-17)15(11-14)21-10-6-16-18-7-8-19(16)2/h4-5,7-8,11H,3,6,9-10,12H2,1-2H3 |
| InChIKey | HXUCSJJMEXFXKE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|