C30H28N4O3 — CID 10672772
4-[3-[[6-(1-methyltetrazol-5-yl)-8-phenylnaphthalen-2-yl]oxymethyl]phenyl]oxan-4-ol (PubChem CID 10672772) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-[3-[[6-(1-methyltetrazol-5-yl)-8-phenylnaphthalen-2-yl]oxymethyl]phenyl]oxan-4-ol.
| Compound Name | 4-[3-[[6-(1-methyltetrazol-5-yl)-8-phenylnaphthalen-2-yl]oxymethyl]phenyl]oxan-4-ol |
|---|---|
| PubChem CID | 10672772 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-[3-[[6-(1-methyltetrazol-5-yl)-8-phenylnaphthalen-2-yl]oxymethyl]phenyl]oxan-4-ol |
| SMILES | Cn1nnnc1-c1cc(-c2ccccc2)c2cc(OCc3cccc(C4(O)CCOCC4)c3)ccc2c1 |
| InChI | InChI=1S/C30H28N4O3/c1-34-29(31-32-33-34)24-17-23-10-11-26(19-28(23)27(18-24)22-7-3-2-4-8-22)37-20-21-6-5-9-25(16-21)30(35)12-14-36-15-13-30/h2-11,16-19,35H,12-15,20H2,1H3 |
| InChIKey | QZJRVGICRTYEAP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |