C12H20O5S — CID 106727898
2-oxo-1-(2-propan-2-ylsulfonylethyl)cyclohexane-1-carboxylic acid (PubChem CID 106727898) has the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. Its IUPAC name is 2-oxo-1-(2-propan-2-ylsulfonylethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-oxo-1-(2-propan-2-ylsulfonylethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106727898 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-oxo-1-(2-propan-2-ylsulfonylethyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)S(=O)(=O)CCC1(C(=O)O)CCCCC1=O |
| InChI | InChI=1S/C12H20O5S/c1-9(2)18(16,17)8-7-12(11(14)15)6-4-3-5-10(12)13/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | HGNVLVIGZYYJQE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|