C12H15FO5S2 — CID 106728552
4-fluoro-3-(2-propan-2-ylsulfonylethylsulfinyl)benzoic acid (PubChem CID 106728552) has the molecular formula C12H15FO5S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-fluoro-3-(2-propan-2-ylsulfonylethylsulfinyl)benzoic acid.
| Compound Name | 4-fluoro-3-(2-propan-2-ylsulfonylethylsulfinyl)benzoic acid |
|---|---|
| PubChem CID | 106728552 |
| Molecular Formula | C12H15FO5S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-fluoro-3-(2-propan-2-ylsulfonylethylsulfinyl)benzoic acid |
| SMILES | CC(C)S(=O)(=O)CCS(=O)c1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C12H15FO5S2/c1-8(2)20(17,18)6-5-19(16)11-7-9(12(14)15)3-4-10(11)13/h3-4,7-8H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | QFXLFPVMNJYRPS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |